CymitQuimica logo

CAS 51047-59-7

:

2-methyl-6-piperazin-1-yl-pyrazine

Description:
2-Methyl-6-piperazin-1-yl-pyrazine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a piperazine group, a saturated six-membered ring containing two nitrogen atoms, contributes to its potential biological activity and solubility properties. The methyl group at the 2-position of the pyrazine ring enhances its lipophilicity, which can influence its interaction with biological targets. This compound is often studied for its pharmacological properties, particularly in the context of drug development, as piperazine derivatives are known to exhibit a range of biological activities, including antipsychotic and antidepressant effects. Its molecular structure allows for various functional modifications, making it a versatile scaffold in medicinal chemistry. Additionally, the compound's stability, reactivity, and solubility can be influenced by the presence of the piperazine moiety and the methyl substituent, which are important factors in its application in pharmaceutical formulations.
Formula:C9H14N4
InChI:InChI=1/C9H14N4/c1-8-6-11-7-9(12-8)13-4-2-10-3-5-13/h6-7,10H,2-5H2,1H3
InChI key:ZQAVHWZTBHGKFK-UHFFFAOYSA-N
SMILES:Cc1cncc(n1)N1CCNCC1
Synonyms:
  • 2-Methyl-6-Piperazin-1-Ylpyrazine
Found 3 products.