CymitQuimica logo

CAS 51052-79-0

:

4-Piperidinepropanoic acid, hydrochloride

Description:
4-Piperidinepropanoic acid, hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a propanoic acid side chain, contributing to its acidic properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the piperidine moiety often imparts biological activity, and compounds of this class may exhibit properties such as analgesic or anti-inflammatory effects. The hydrochloride form is commonly used to improve the stability and bioavailability of the active compound. In terms of safety, like many chemical substances, it should be handled with care, following appropriate safety protocols to avoid exposure. Overall, 4-Piperidinepropanoic acid, hydrochloride is a versatile compound with potential applications in medicinal chemistry and research.
Formula:C8H15NO2ClH
InChI:InChI=1S/C8H15NO2.ClH/c10-8(11)2-1-7-3-5-9-6-4-7;/h7,9H,1-6H2,(H,10,11);1H
InChI key:XJKGRWLZAWTSOY-UHFFFAOYSA-N
SMILES:C1CNCCC1CCC(=O)O.Cl
Found 5 products.