CymitQuimica logo

CAS 51061-22-4

:

2-[3-(benzyloxy)phenyl]ethanamine

Description:
2-[3-(Benzyloxy)phenyl]ethanamine, with the CAS number 51061-22-4, is an organic compound characterized by its amine functional group and a phenyl ring substituted with a benzyloxy group. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine group. The benzyloxy substituent can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the ethylamine chain may impart basicity to the molecule, allowing it to participate in various chemical reactions, including those involving nucleophilic attack. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as intermediates in pharmaceutical research. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H17NO
InChI:InChI=1/C15H17NO/c16-10-9-13-7-4-8-15(11-13)17-12-14-5-2-1-3-6-14/h1-8,11H,9-10,12,16H2
InChI key:STZMTXBXSFWOBA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1cccc(CCN)c1
Synonyms:
  • 2-(3-Benzyloxy-phenyl)-ethylamine
  • 51061-22-4
Found 1 products.