CAS 51067-38-0
:4-Phenoxyphenyl boronic acid
Description:
4-Phenoxyphenyl boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a phenoxy group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the phenoxy group enhances its reactivity and solubility, allowing it to participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is pivotal in the formation of carbon-carbon bonds. Additionally, 4-Phenoxyphenyl boronic acid may exhibit biological activity, making it a candidate for further research in drug development. Its stability and reactivity can be influenced by pH and the presence of other functional groups, which is important for its application in synthetic methodologies.
Formula:C12H11BO3
InChI:InChI=1/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H
SMILES:c1ccc(cc1)Oc1ccc(cc1)B(O)O
Synonyms:- 4-Phenoxybenzene boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Phenoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H11BO3Purity:97.0 to 110.0 %Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:214.034-Phenoxyphenylboronic acid
CAS:Formula:C12H11BO3Purity:98%Color and Shape:SolidMolecular weight:214.02494-Phenoxybenzeneboronic acid
CAS:4-Phenoxybenzeneboronic acidFormula:C12H11BO3Purity:98%Color and Shape:SolidMolecular weight:214.024944-Phenoxyphenylboronic acid
CAS:Formula:C12H11BO3Purity:98%Color and Shape:SolidMolecular weight:214.034-Phenoxyphenylboronic acid
CAS:(4-Phenoxyphenyl)boronic acidFormula:C12H11BO3Purity:98%Molecular weight:214.024-Phenoxyphenylboronic acid
CAS:4-Phenoxyphenylboronic acid is a chemical inhibitor of protein kinase. It binds to the ATP binding site of the enzyme and prevents ATP from binding, thereby inhibiting the phosphorylation of proteins. This inhibition blocks the activation of downstream pathways that are involved in cell proliferation, leading to apoptotic cell death. 4-Phenoxyphenylboronic acid has been shown to inhibit growth of human cancer cells in vitro. This molecule also inhibits root formation and plant growth, which may be due to its ability to selectively inhibit protein kinases found in plant cells.
Formula:C12H11BO3Purity:Min. 95%Molecular weight:214.02 g/mol






