CymitQuimica logo

CAS 51067-85-7

:

dl-A-hydroxylauric acid methyl ester

Description:
dl-A-Hydroxylauric acid methyl ester, with the CAS number 51067-85-7, is an ester derived from lauric acid, a medium-chain fatty acid. This compound features a hydroxyl group (-OH) at the alpha position relative to the carboxylic acid group, which contributes to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the methyl ester group enhances its solubility in organic solvents while maintaining some hydrophilic characteristics due to the hydroxyl group. This compound is often studied for its potential applications in pharmaceuticals, cosmetics, and as a surfactant due to its emulsifying properties. Additionally, it may exhibit antimicrobial activity, making it of interest in various industrial applications. As with many esters, it is expected to have a relatively low toxicity profile, but safety data should always be consulted for handling and usage. Overall, dl-A-hydroxylauric acid methyl ester represents a versatile chemical with potential utility in multiple fields.
Formula:C13H26O3
InChI:InChI=1/C13H26O3/c1-3-4-5-6-7-8-9-10-11-12(14)13(15)16-2/h12,14H,3-11H2,1-2H3
SMILES:CCCCCCCCCCC(C(=O)OC)O
Synonyms:
  • Methyl 2-Hydroxydodecanoate
Found 1 products.