CymitQuimica logo

CAS 51068-58-7

:

1H-Azepine, hexahydro-1-(hydroxyacetyl)-

Description:
1H-Azepine, hexahydro-1-(hydroxyacetyl)-, identified by its CAS number 51068-58-7, is a cyclic organic compound featuring a seven-membered nitrogen-containing ring known as azepine. This compound is characterized by its hexahydro structure, indicating that it has undergone hydrogenation, resulting in a saturated ring. The presence of a hydroxyacetyl group introduces functional diversity, contributing to its potential reactivity and interactions in various chemical environments. Typically, compounds like this may exhibit properties such as solubility in polar solvents due to the hydroxyl group, and they may participate in hydrogen bonding. The azepine ring can also influence the compound's biological activity, making it of interest in medicinal chemistry and drug development. Overall, the unique structure of 1H-Azepine, hexahydro-1-(hydroxyacetyl)- suggests potential applications in pharmaceuticals, though specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c10-7-8(11)9-5-3-1-2-4-6-9/h10H,1-7H2
InChI key:WLAFVVDXJLJATJ-UHFFFAOYSA-N
SMILES:C1CCCN(CC1)C(=O)CO
Found 1 products.