CymitQuimica logo

CAS 510754-90-2

:

tert-butyl (9-aminononyl)carbamate

Description:
Tert-butyl (9-aminononyl)carbamate is an organic compound characterized by its carbamate functional group, which consists of a tert-butyl group attached to a nonylamine moiety. This compound typically exhibits properties such as being a solid or viscous liquid at room temperature, depending on its specific formulation and purity. It is generally soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the tert-butyl and nonyl groups. The presence of the amino group suggests potential reactivity, particularly in forming hydrogen bonds or participating in nucleophilic reactions. Tert-butyl (9-aminononyl)carbamate may be utilized in various applications, including as a reagent in organic synthesis or as an intermediate in the production of pharmaceuticals and agrochemicals. Safety considerations should be taken into account, as with many organic compounds, including proper handling and storage to avoid exposure. Overall, its unique structure and functional groups contribute to its utility in chemical synthesis and research.
Formula:C14H30N2O2
InChI:InChI=1/C14H30N2O2/c1-14(2,3)18-13(17)16-12-10-8-6-4-5-7-9-11-15/h4-12,15H2,1-3H3,(H,16,17)
InChI key:GZUNGYDAMPRXSU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCCCCCCCCCN)O
Found 6 products.