CAS 511-07-9
:Ergocristinine
Description:
Ergocristinine, with the CAS number 511-07-9, is a naturally occurring alkaloid derived from the ergot fungus, specifically from the species Claviceps purpurea. It is part of the broader group of ergot alkaloids, which are known for their complex structures and diverse biological activities. Ergocristinine exhibits a range of pharmacological effects, including vasoconstriction and potential neuroactivity, making it of interest in both medicinal chemistry and pharmacology. The compound is characterized by its ability to interact with various neurotransmitter receptors, particularly those related to serotonin and dopamine pathways. Ergocristinine has been studied for its potential therapeutic applications, although its use is limited due to the side effects associated with ergot alkaloids, such as vasospasm and other cardiovascular issues. Additionally, its chemical structure includes multiple chiral centers, contributing to its stereochemical complexity. As with many ergot derivatives, safety and dosage considerations are critical in any potential therapeutic context.
Formula:C35H39N5O5
InChI:InChI=1/C35H39N5O5/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34/h4-7,9-12,16,18,20,23,27-29,36,44H,8,13-15,17,19H2,1-3H3,(H,37,41)/t23-,27+,28-,29-,34+,35-/m0/s1
InChI key:InChIKey=HEFIYUQVAZFDEE-NASJTFDLSA-N
SMILES:O[C@@]12N([C@@H](CC3=CC=CC=C3)C(=O)N4[C@]1(CCC4)[H])C(=O)[C@@](NC(=O)[C@H]5C=C6C=7C=8C(C[C@]6(N(C)C5)[H])=CNC8C=CC7)(C(C)C)O2
Synonyms:- (5'Alpha,8Alpha)-5'-Benzyl-12'-Hydroxy-2'-(1-Methylethyl)-3',6',18-Trioxoergotaman
- (5Alpha,5'Beta)-5'-Benzyl-12'-Hydroxy-3',6',18-Trioxo-2'-(Propan-2-Yl)Ergotaman
- (5′α,8α)-12′-Hydroxy-2′-(1-methylethyl)-5′-(phenylmethyl)ergotaman-3′,6′,18-trione
- (8alpha)-5'alpha-Benzyl-12'-hydroxy-2'-isopropylergotaman-3',6',18-trione
- 8H-Oxazolo[3,2-a]pyrrolo[2,1-c]pyrazine, ergotaman-3′,6′,18-trione deriv.
- Ergocristinine
- Ergotaman-3',6',18-trione, 12'-hydroxy-2'-(1-methylethyl)-5'-(phenylmethyl)-, (5'alpha,8alpha)-
- Ergotaman-3′,6′,18-trione, 12′-hydroxy-2′-(1-methylethyl)-5′-(phenylmethyl)-, (5′α,8α)-
- Indolo[4,3-fg]quinoline, ergotaman-3′,6′,18-trione deriv.
- Isoergocristine
- (5'alpha,8alpha)-12'-Hydroxy-2'-(1-methylethyl)-5'-(phenylmethyl)ergotaman-3',6',18-trione
- Ergotaman-3',6',18-trione, 12'-hydroxy-2'-(1-methylethyl)-5'-(phenylmethyl)-, (5'α,8α)-
- 8a-isomer
- Einecs 208-119-1
- See more synonyms
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ergocristinine
CAS:Controlled ProductErgocristinine is a secondary metabolite that belongs to the ergoline alkaloid family. It has been isolated from a bacterial strain and identified as an ergocryptine derivative. Ergocristinine inhibits matrix metalloproteinases, thereby preventing the breakdown of collagen in skin cells. This compound also inhibits the activity of certain enzymes in humans and mice, including phospholipase A2, cyclooxygenase-1, and cyclooxygenase-2. Ergocristinine has been shown to have anti-inflammatory properties by inhibiting prostaglandin synthesis. The analytical method for ergocristine involves the use of LC-MS/MS with a fluorescence detector.Formula:C35H39N5O5Purity:Min. 95%Molecular weight:609.72 g/mol


