CymitQuimica logo

CAS 51100-47-1

:

Heptanoic acid, 7-bromo-, 1,1-dimethylethyl ester

Description:
Heptanoic acid, 7-bromo-, 1,1-dimethylethyl ester, with the CAS number 51100-47-1, is an organic compound characterized by its ester functional group derived from heptanoic acid and a bromo substituent at the seventh carbon position. This compound typically exhibits a moderate molecular weight and is likely to be a colorless to pale yellow liquid at room temperature. Its structure includes a branched alkyl group due to the presence of the 1,1-dimethylethyl moiety, which contributes to its steric hindrance and may influence its reactivity and solubility properties. Heptanoic acid derivatives are known for their applications in the synthesis of various chemical intermediates, fragrances, and as surfactants. The presence of the bromine atom may impart unique reactivity, making it a potential candidate for further chemical transformations. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health hazards or environmental risks.
Formula:C11H21BrO2
InChI:InChI=1S/C11H21BrO2/c1-11(2,3)14-10(13)8-6-4-5-7-9-12/h4-9H2,1-3H3
InChI key:XZMQZUGTGFBLIP-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)CCCCCCBr
Found 5 products.