CymitQuimica logo

CAS 51102-41-1

:

3-Methyl-3,8-diaza-bicyclo[3.2.1]octane

Description:
3-Methyl-3,8-diaza-bicyclo[3.2.1]octane, with the CAS number 51102-41-1, is a bicyclic compound featuring a unique structure that includes two nitrogen atoms incorporated into its bicyclic framework. This compound is characterized by its nitrogen-rich structure, which contributes to its potential biological activity and applications in medicinal chemistry. The presence of the methyl group at the 3-position enhances its steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. As a bicyclic amine, it may exhibit basic properties due to the nitrogen atoms, which can participate in hydrogen bonding and coordination with metal ions. The compound's structural features may also allow for conformational flexibility, impacting its pharmacokinetic properties. While specific data on its solubility, melting point, and other physical properties may vary, compounds of this class are often investigated for their potential use in drug development, particularly in the context of neuropharmacology and as scaffolds for synthesizing more complex molecules.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-9-4-6-2-3-7(5-9)8-6/h6-8H,2-5H2,1H3
InChI key:OQMSHITZFTVBHN-UHFFFAOYSA-N
SMILES:CN1CC2CCC(C1)N2
Found 5 products.