CymitQuimica logo

CAS 511230-72-1

:

methyl 6-bromo-1,2,3,4-tetrahydroquinoline-2-carboxylate

Description:
Methyl 6-bromo-1,2,3,4-tetrahydroquinoline-2-carboxylate is a chemical compound characterized by its unique structure, which includes a tetrahydroquinoline core with a bromine substituent and a carboxylate ester functional group. This compound typically exhibits properties associated with both heterocyclic compounds and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The tetrahydroquinoline framework contributes to its potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Additionally, the methyl ester group can influence its lipophilicity and bioavailability. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, methyl 6-bromo-1,2,3,4-tetrahydroquinoline-2-carboxylate represents a versatile structure with potential applications in various fields, including organic synthesis and drug discovery.
Formula:C11H12BrNO2
InChI:InChI=1/C11H12BrNO2/c1-15-11(14)10-4-2-7-6-8(12)3-5-9(7)13-10/h3,5-6,10,13H,2,4H2,1H3
InChI key:AUAAQBWEOAMYGG-UHFFFAOYSA-N
SMILES:COC(=O)C1CCc2cc(ccc2N1)Br
Synonyms:
  • 2-Quinolinecarboxylic acid, 6-bromo-1,2,3,4-tetrahydro-, methyl ester
  • 6-Bromo-1,2,3,4-tetrahydro-quinoline-2-carboxylic acid methyl ester
Found 3 products.