CymitQuimica logo

CAS 511272-31-4

:

Fmoc-(R)-3-Amino-3-(2-methoxyphenyl)-propionic acid

Description:
Fmoc-(R)-3-Amino-3-(2-methoxyphenyl)-propionic acid is a chemical compound commonly used in peptide synthesis and drug development. It features a phenylalanine derivative with a 2-methoxy substituent, which enhances its hydrophobic character and can influence the conformation of peptides. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective moiety for the amino group, allowing for selective deprotection during synthesis. This compound is characterized by its chiral center, which contributes to its potential biological activity and specificity in interactions with biological targets. Its structure includes an amino group, a carboxylic acid, and a side chain that can participate in various chemical reactions. The presence of the methoxy group can also affect solubility and reactivity. Overall, Fmoc-(R)-3-Amino-3-(2-methoxyphenyl)-propionic acid is valuable in the field of medicinal chemistry and peptide research due to its unique structural features and functional properties.
Formula:C25H23NO5
InChI:InChI=1S/C25H23NO5/c1-30-23-13-7-6-12-20(23)22(14-24(27)28)26-25(29)31-15-21-18-10-4-2-8-16(18)17-9-3-5-11-19(17)21/h2-13,21-22H,14-15H2,1H3,(H,26,29)(H,27,28)/t22-/m1/s1
InChI key:JMHQFXYSVGDAGJ-JOCHJYFZSA-N
SMILES:COC1=CC=CC=C1[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Synonyms:
  • Fmoc-(R)-3-Amino-3-(2-Methoxy-Phenyl)-Propionic Acid
Found 3 products.