CymitQuimica logo

CAS 51129-66-9

:

2-Furancarboxylic acid, 5-(cyanomethyl)-, ethyl ester

Description:
2-Furancarboxylic acid, 5-(cyanomethyl)-, ethyl ester, also known by its CAS number 51129-66-9, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of the cyanomethyl group enhances its potential for nucleophilic reactions, making it a valuable intermediate in organic synthesis. Typically, this compound is a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which facilitates its use in various chemical reactions. The compound's unique structure allows it to participate in diverse chemical transformations, including esterification and nucleophilic addition reactions. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, 2-Furancarboxylic acid, 5-(cyanomethyl)-, ethyl ester is significant in synthetic organic chemistry and material science.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c1-2-12-9(11)8-4-3-7(13-8)5-6-10/h3-4H,2,5H2,1H3
InChI key:UWWMGPPIOJFSMF-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC=C(O1)CC#N
Synonyms:
  • Ethyl 5-(cyanomethyl)furan-2-carboxylate
Found 4 products.