CAS 51131-85-2
:9-Hydroxyellipticine
Description:
9-Hydroxyellipticine is a naturally occurring alkaloid derived from the plant species of the genus *Micromeria*, known for its potential pharmacological properties. It is characterized by its complex polycyclic structure, which includes a fused indole and quinoline moiety. This compound exhibits notable biological activities, particularly as an antitumor agent, and has been studied for its ability to intercalate with DNA, thereby inhibiting topoisomerase enzymes, which are crucial for DNA replication and transcription. The presence of the hydroxyl group at the 9-position enhances its solubility and reactivity, contributing to its biological efficacy. Additionally, 9-Hydroxyellipticine has shown promise in various in vitro and in vivo studies, indicating its potential as a lead compound for the development of new anticancer therapies. Its chemical properties, including stability and reactivity, make it a subject of interest in medicinal chemistry and drug design. As with many alkaloids, the safety and efficacy of 9-Hydroxyellipticine in clinical settings require further investigation through rigorous research and clinical trials.
Formula:C17H14N2O
InChI:InChI=1S/C17H14N2O/c1-9-14-8-18-6-5-12(14)10(2)17-16(9)13-7-11(20)3-4-15(13)19-17/h3-8,19-20H,1-2H3
InChI key:InChIKey=QZTWUDDGLIDXSE-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(C)C=3C1=CN=CC3)NC=4C2=CC(O)=CC4
Synonyms:- 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol hydrochloride (1:1)
- 6H-Pyrido(4,3-b)carbazol-9-ol, 5,11-dimethyl-
- 9-Hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole
- 9-Hydroxyellipticin
- 9-Hydroxyellipticine
- Ellipticine, 9-Hydroxy-
- Hydroxy-9 ellipticine
- Hydroxy-9 ellipticine [French]
- Hydroxyellipticine
- Igig 929
- Nsc 210717
- Nsc 237070
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
9-Hydroxyellipticin free base
CAS:9-hydroxyellipticine is a potent cytotoxic and antitumor agent. 9-hydroxyellipticine is a 9-hydroxy derivative of ellipticine.Formula:C17H14N2OColor and Shape:SolidMolecular weight:262.319-Hydroxyellipticine
CAS:9-Hydroxyellipticine is a molecule that binds to the ryanodine receptor, which is a calcium channel in cells. It has been shown to induce denaturation of proteins and inhibit DNA synthesis in rat liver microsomes. 9-Hydroxyellipticine can also bind to the epoxidase activity and subunits of cytochrome P450. The binding of 9-hydroxyellipticine to the cytochrome P450 enzyme prevents it from metabolizing foreign compounds, which may lead to cancer or other diseases. 9-Hydroxyellipticine has also been shown to inhibit proteases that break down proteins and peptides, inhibiting protein synthesis.
Formula:C17H14N2OPurity:Min. 95%Molecular weight:262.3 g/molRef: 3D-BCA13185
Discontinued product

