CymitQuimica logo

CAS 51135-91-2

:

4-amino-2,3-dihydro-1H-inden-1-one

Description:
4-Amino-2,3-dihydro-1H-inden-1-one is an organic compound characterized by its bicyclic structure, which includes an indene core with an amino group and a carbonyl group. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the amino and carbonyl functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility in water and other polar solvents. The compound may exhibit basic properties due to the amino group, allowing it to act as a nucleophile in various chemical reactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as derivatives of indene compounds often show biological activity. Additionally, the presence of the carbonyl group may allow for further functionalization, making it a versatile intermediate in organic synthesis. Overall, 4-amino-2,3-dihydro-1H-inden-1-one is a compound of interest for its chemical reactivity and potential applications in various fields.
Formula:C9H9NO
InChI:InChI=1/C9H9NO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5,10H2
InChI key:HCPYYLKYVRPDKI-UHFFFAOYSA-N
SMILES:c1cc2c(CCC2=O)c(c1)N
Synonyms:
  • 1H-inden-1-one, 4-amino-2,3-dihydro-
  • 4-Aminoindan-1-on
  • 4-Aminoindan-1-One
  • 4-Amino-1-Indanone
Found 4 products.