CymitQuimica logo

CAS 51149-87-2

:

1-Naphthalenol, 5-methyl-

Description:
1-Naphthalenol, 5-methyl- is an organic compound characterized by its naphthalene structure with a hydroxyl group (-OH) and a methyl group (-CH3) attached to the naphthalene ring. This compound is part of the naphthol family, which are phenolic compounds known for their aromatic properties. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding, which can influence its reactivity and solubility in various media. 1-Naphthalenol, 5-methyl- is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical products. Its chemical behavior is influenced by the positions of the substituents on the naphthalene ring, which can affect its acidity, reactivity, and interaction with other molecules. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H10O
InChI:InChI=1S/C11H10O/c1-8-4-2-6-10-9(8)5-3-7-11(10)12/h2-7,12H,1H3
InChI key:IFFNCYKOPFBODF-UHFFFAOYSA-N
SMILES:CC1=C2C=CC=C(C2=CC=C1)O
Found 1 products.