CymitQuimica logo

CAS 51171-71-2

:

4-phenylcyclohex-3-en-1-one

Description:
4-Phenylcyclohex-3-en-1-one, with the CAS number 51171-71-2, is an organic compound characterized by its unique structure, which features a cyclohexene ring substituted with a phenyl group and a ketone functional group. This compound typically exhibits a yellow to light brown appearance and is known for its aromatic properties due to the presence of the phenyl group. It is a member of the class of compounds known as enones, which are characterized by the presence of a carbonyl group (C=O) adjacent to a double bond. The compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic nature. Its reactivity can be attributed to the conjugated system formed by the double bond and the carbonyl group, making it a potential candidate for various chemical reactions, including Michael additions and Diels-Alder reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry and organic synthesis.
Formula:C12H12O
InChI:InChI=1/C12H12O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-6H,7-9H2
SMILES:c1ccc(cc1)C1=CCC(=O)CC1
Found 1 products.