CAS 51175-79-2

Cyclobutanecarboxylic acid, 1-bromo-, methyl ester

Description:

Cyclobutanecarboxylic acid, 1-bromo-, methyl ester is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a carboxylic acid functional group and a bromine atom at the first carbon position, along with a methyl ester group, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic cyclobutane ring. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The compound may exhibit moderate to low toxicity, and safety precautions should be taken when handling it. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on the specific reactivity and functionalization of the molecule. As with many organic compounds, proper storage and handling are essential to maintain stability and prevent degradation.

Formula: C₆H₉BrO₂

InChI: InChI=1S/C6H9BrO2/c1-9-5(8)6(7)3-2-4-6/h2-4H2,1H3

InChI key: KOKFKKDTWBKYTQ-UHFFFAOYSA-N

SMILES: COC(=O)C1(CCC1)Br

Synonyms:

• 1-Bromo Cyclobutane Carboxylate

Methyl 1-bromocyclobutane-1-carboxylate

CAS: 51175-79-2

Methyl 1-bromocyclobutane-1-carboxylate

Formula: C₆H₉BrO₂

Purity: 98%

Molecular weight: 193.04

Ref: 54-OR90120

Methyl 1-bromocyclobutanecarboxylate

CAS: 51175-79-2

Formula: C₆H₉BrO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 193.0385

Ref: IN-DA00DJ7C

Methyl 1-bromocyclobutanecarboxylate

CAS: 51175-79-2

Methyl 1-bromocyclobutanecarboxylate

Formula: C₆H₉BrO₂

Purity: 97%

Molecular weight: 193.04

Ref: IN-DG208523

Methyl 1-bromocyclobutanecarboxylate

CAS: 51175-79-2

Methyl 1-bromocyclobutanecarboxylate is an alicyclic compound that can be synthesized by the reaction of methyl acetoacetate, formaldehyde and hydrogen bromide. The product can be analyzed using x-ray crystallography to determine its structural properties. The structural analysis suggests that there are two possible substituents on the nitrogen atom.

Formula: C₆H₉BrO₂

Purity: Min. 95%

Molecular weight: 193.04 g/mol

Ref: 3D-BCA17579