CymitQuimica logo

CAS 51175-80-5

:

1-bromocyclobutanecarboxamide

Description:
1-Bromocyclobutanecarboxamide is an organic compound characterized by its cyclobutane ring structure, which is substituted with a bromine atom and a carboxamide functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxamide group contributes to the compound's polarity and solubility in polar solvents, enhancing its potential applications in organic synthesis and medicinal chemistry. This compound may exhibit specific physical properties such as a distinct boiling point and melting point, influenced by its molecular structure and intermolecular interactions. Additionally, the presence of both the bromine and amide functionalities can affect its biological activity, making it of interest in pharmaceutical research. Safety considerations should be taken into account due to the reactivity of brominated compounds and the potential toxicity associated with amides. Overall, 1-bromocyclobutanecarboxamide serves as a valuable building block in organic synthesis and may have implications in various fields, including drug development and materials science.
Formula:C5H8BrNO
InChI:InChI=1/C5H8BrNO/c6-5(4(7)8)2-1-3-5/h1-3H2,(H2,7,8)
InChI key:NWTUHUOQBOFSPL-UHFFFAOYSA-N
SMILES:C1CC(C1)(C(=N)O)Br
Found 5 products.