CymitQuimica logo

CAS 512-35-6

:

Benzenesulfonicanhydride

Description:
Benzenesulfonicanhydride, with the CAS number 512-35-6, is an organic compound characterized by its anhydride functional group derived from benzenesulfonic acid. It typically appears as a white to light yellow crystalline solid and is known for its strong electrophilic properties, making it a useful reagent in organic synthesis. The compound is soluble in organic solvents such as acetone and ether but is generally insoluble in water due to its hydrophobic aromatic structure. Benzenesulfonicanhydride is primarily utilized in the synthesis of sulfonamide compounds and as a coupling agent in various chemical reactions. It can react with nucleophiles, leading to the formation of sulfonamides or other derivatives. Due to its reactivity, it should be handled with care, as it can cause irritation to the skin and eyes. Proper safety measures, including the use of personal protective equipment, are recommended when working with this compound in a laboratory setting.
Formula:C12H10O5S2
InChI:InChI=1/C12H10O5S2/c13-18(14,11-7-3-1-4-8-11)17-19(15,16)12-9-5-2-6-10-12/h1-10H
InChI key:MLWPJXZKQOPTKZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)S(=O)(=O)OS(=O)(=O)c1ccccc1
Synonyms:
  • Benzenesulfonic anhydride
  • Benzenesulfonyl Benzenesulfonate
Found 4 products.