CAS 512-69-6: raffinose, pure
Description:Raffinose is a complex carbohydrate classified as a trisaccharide, composed of three monosaccharides: galactose, glucose, and fructose. It is primarily found in various plants, particularly in beans, cabbage, brussels sprouts, broccoli, and whole grains. Raffinose is notable for its role in human nutrition, as it is not easily digestible due to the lack of the enzyme alpha-galactosidase in the human gastrointestinal tract. This can lead to fermentation by gut bacteria, resulting in gas production and potential digestive discomfort. Chemically, raffinose has a molecular formula of C18H32O16 and a molecular weight of approximately 504.44 g/mol. It is soluble in water and exhibits a sweet taste, although it is less sweet than sucrose. Raffinose is often used in food products and dietary supplements for its prebiotic properties, promoting beneficial gut bacteria. Additionally, it has applications in the food industry as a stabilizer and bulking agent. Its CAS number, 512-69-6, uniquely identifies this substance in chemical databases.
Formula:C18H32O16
InChI:InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1
InChI key:InChIKey=MUPFEKGTMRGPLJ-ZQSKZDJDSA-N
SMILES:OCC1OC(OCC2OC(OC3(OC(CO)C(O)C3O)CO)C(O)C(O)C2O)C(O)C(O)C1O
- Synonyms:
- <span class="text-smallcaps">D</span>-(+)-Raffinose
- D-(+)-Raffinose
- Gossypose
- Meiji Beet Oligo FP
- Melitose
- Melitriose
- Nittenraffinose
- Nsc 170228
- Nsc 2025
- Oligo GGF
- See more synonyms
- Raffinose
- Raffinose hydrate
- Rafinosa
- beta-D-fructofuranosyl D-galactopyranosyl-(1->6)-D-glucopyranoside
- α-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, β-<smallcap>D</smallcap>-fructofuranosyl O-α-<smallcap>D</span>-galactopyranosyl-(1→6)-
- α-D-Glucopyranoside, β-D-fructofuranosyl O-α-D-galactopyranosyl-(1→6)-
- β-<span class="text-smallcaps">D</smallcap>-Fructofuranosyl O-α-<smallcap>D</smallcap>-galactopyranosyl-(1→6)-α-<smallcap>D</span>-glucopyranoside
- β-D-Fructofuranosyl O-α-D-galactopyranosyl-(1→6)-α-D-glucopyranoside
