CAS 5120-23-0: Phosfolan-methyl
Description:Phosfolan-methyl, with the CAS number 5120-23-0, is an organophosphorus compound primarily used as an insecticide and acaricide in agricultural applications. It is characterized by its ability to inhibit acetylcholinesterase, an enzyme crucial for the proper functioning of the nervous system in insects, leading to paralysis and death. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. Its solubility in organic solvents is notable, while its water solubility is relatively low, which influences its application methods and environmental behavior. Phosfolan-methyl is subject to regulatory scrutiny due to its potential toxicity to non-target organisms, including humans and wildlife, necessitating careful handling and application practices. Additionally, it may undergo degradation in the environment, influenced by factors such as temperature, pH, and microbial activity. As with many pesticides, understanding its mode of action, environmental fate, and safety measures is essential for effective and responsible use in pest management strategies.
Formula:C5H10NO3PS2
InChI:InChI=1S/C5H10NO3PS2/c1-8-10(7,9-2)6-5-11-3-4-12-5/h3-4H2,1-2H3
InChI key:InChIKey=CWXVDJFKMQCYFG-UHFFFAOYSA-N
SMILES:O=P(N=C1SCCS1)(OC)OC
- Synonyms:
- Phosphoramidic acid, N-1,3-dithiolan-2-ylidene-, dimethyl ester
- Phosfolan-methyl
- 1,2-Ethanedithiol, cyclic ester with phosphonodithioimidocarbonic acid P,P-dimethyl ester
- Imidocarbonic acid, phosphonodithio-, cyclic ethylene P,P-dimethyl ester
- Phosphoramidic acid, 1,3-dithiolan-2-ylidene-, dimethyl ester
