CAS 51207-84-2
:Benzamide, 4-amino-N-butyl-
Description:
Benzamide, 4-amino-N-butyl- is an organic compound characterized by the presence of a benzamide functional group with an amino group and a butyl substituent. Its molecular structure features a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) at the para position relative to the carbonyl. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amine group, which can engage in hydrogen bonding. The butyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Benzamide derivatives are often studied for their biological activities, including potential pharmaceutical applications, as they can interact with various biological targets. The presence of both the amino and carbonyl groups allows for diverse chemical reactivity, making it a useful intermediate in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-2-3-8-13-11(14)9-4-6-10(12)7-5-9/h4-7H,2-3,8,12H2,1H3,(H,13,14)
InChI key:FLXMHAHQLCYFOI-UHFFFAOYSA-N
SMILES:CCCCNC(=O)C1=CC=C(C=C1)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
