CymitQuimica logo

CAS 5122-07-6

:

1-ethynyl-2,3,4,5,6-pentafluorobenzene

Description:
1-Ethynyl-2,3,4,5,6-pentafluorobenzene is a fluorinated aromatic compound characterized by the presence of five fluorine atoms and an ethynyl group attached to a benzene ring. This compound features a highly substituted aromatic system, which contributes to its unique chemical properties, including increased stability and reactivity due to the electronegative fluorine atoms. The presence of the ethynyl group introduces a triple bond, enhancing its potential for further chemical reactions, such as coupling reactions or polymerization. The fluorine substituents significantly influence the compound's physical properties, such as boiling and melting points, making it more polar and potentially altering its solubility in various solvents. Additionally, the compound's structure may impart interesting electronic properties, making it useful in materials science and organic synthesis. Due to its fluorinated nature, it may also exhibit unique interactions with biological systems, warranting careful handling and consideration in applications. Overall, 1-ethynyl-2,3,4,5,6-pentafluorobenzene is a notable compound in the field of organic chemistry and materials science.
Formula:C8HF5
InChI:InChI=1/C8HF5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h1H
InChI key:PBEXVWXHXPEARD-UHFFFAOYSA-N
SMILES:C#Cc1c(c(c(c(c1F)F)F)F)F
Synonyms:
  • Benzene, 1-ethynyl-2,3,4,5,6-pentafluoro-
Found 4 products.