CAS 5122-99-6
:4-Iodophenylboronic acid
Description:
4-Iodophenylboronic acid is an organoboron compound characterized by the presence of both a boronic acid group and an iodine atom attached to a phenyl ring. Its molecular structure features a boron atom bonded to a hydroxyl group and a phenyl group that is further substituted with an iodine atom at the para position. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It is known for its utility in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a versatile building block for the formation of biaryl compounds. The presence of the iodine atom enhances its reactivity and facilitates various transformations. Additionally, 4-iodophenylboronic acid can act as a ligand in coordination chemistry and has potential applications in medicinal chemistry due to its ability to interact with biological targets. Safety precautions should be observed when handling this compound, as boronic acids can be irritants and the iodine moiety may pose additional hazards.
Formula:C6H6BIO2
InChI:InChI=1/C6H6BIO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H
InChI key:PELJYVULHLKXFF-UHFFFAOYSA-N
SMILES:c1cc(ccc1B(O)O)I
Synonyms:- p-Iodobenzeneboronic acid
- Benzeneboronic acid, p-iodo-
- P-Iodophenylboronic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Iodophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H6BIO2Color and Shape:White to Almost white powder to crystalMolecular weight:247.834-Iodobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6BIO2Purity:97%Molecular weight:247.83(4-Iodophenyl)boronic acid
CAS:Formula:C6H6BIO2Purity:96%Color and Shape:SolidMolecular weight:247.82614-Iodobenzeneboronic acid
CAS:4-Iodobenzeneboronic acidFormula:C6H6BIO2Purity:97%Color and Shape:Solid-PowderMolecular weight:247.82611(4-Iodophenyl)boronic acid
CAS:(4-Iodophenyl)boronic acidFormula:C6H6BIO2Purity:97%Molecular weight:247.83





