CAS 5122-99-6
:4-Iodophenylboronic acid
Description:
4-Iodophenylboronic acid is an organoboron compound characterized by the presence of both a boronic acid group and an iodine atom attached to a phenyl ring. Its molecular structure features a boron atom bonded to a hydroxyl group and a phenyl group that is further substituted with an iodine atom at the para position. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It is known for its utility in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a versatile building block for the formation of biaryl compounds. The presence of the iodine atom enhances its reactivity and facilitates various transformations. Additionally, 4-iodophenylboronic acid can act as a ligand in coordination chemistry and has potential applications in medicinal chemistry due to its ability to interact with biological targets. Safety precautions should be observed when handling this compound, as boronic acids can be irritants and the iodine moiety may pose additional hazards.
Formula:C6H6BIO2
InChI:InChI=1/C6H6BIO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H
SMILES:c1cc(ccc1B(O)O)I
Synonyms:- p-Iodobenzeneboronic acid
- Benzeneboronic acid, p-iodo-
- P-Iodophenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Iodophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H6BIO2Color and Shape:White to Almost white powder to crystalMolecular weight:247.834-Iodobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6BIO2Purity:97%Molecular weight:247.83(4-Iodophenyl)boronic acid
CAS:Formula:C6H6BIO2Purity:97%Color and Shape:SolidMolecular weight:247.82614-Iodobenzeneboronic acid
CAS:4-Iodobenzeneboronic acidFormula:C6H6BIO2Purity:97%Color and Shape:Solid-PowderMolecular weight:247.82611Ref: 10-F011042
1g12.00€5g23.00€10g42.00€15g60.00€25g98.00€50g175.00€100g320.00€500g1,376.00€1kg2,738.00€4-Iodophenylboronic acid
CAS:4-Iodophenylboronic acid is a chemical compound that has been shown to bind to disaccharides and form hydrogen bonding interactions. It has also been shown to enhance the chemiluminescence of ethylene diamine in a light emission assay, which is due to its ability to bind to fatty acids. 4-Iodophenylboronic acid has been used in studies on tumor xenografts and optical properties. 4-Iodophenylboronic acid has also been shown to have vibrational and nmr spectra that differ from other boronic acids. This compound is unique because it binds with water molecules more strongly than any other boronic acid.Formula:C6H6BIO2Purity:Min. 95%Color and Shape:PowderMolecular weight:247.83 g/mol





