CymitQuimica logo

CAS 51220-52-1

:

{[(4-ethoxyphenyl)carbonyl]amino}acetate

Description:
{[(4-Ethoxyphenyl)carbonyl]amino}acetate, with the CAS number 51220-52-1, is an organic compound characterized by its functional groups, which include an ethoxy group, a carbonyl group, and an amino group. This compound typically exhibits properties associated with both amines and esters, making it a versatile molecule in organic synthesis. The presence of the ethoxy group contributes to its hydrophobic characteristics, while the amino and carbonyl functionalities can engage in hydrogen bonding, influencing its solubility in various solvents. The compound may display moderate stability under standard conditions but could be sensitive to hydrolysis, particularly in the presence of strong acids or bases. Its structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, where the ability to form derivatives is valuable. Additionally, the compound's reactivity can be influenced by the electronic effects of the ethoxy and phenyl groups, which may affect its behavior in chemical reactions. Overall, {[(4-ethoxyphenyl)carbonyl]amino}acetate is a compound of interest for further exploration in chemical research and applications.
Formula:C11H12NO4
InChI:InChI=1/C11H13NO4/c1-2-16-9-5-3-8(4-6-9)11(15)12-7-10(13)14/h3-6H,2,7H2,1H3,(H,12,15)(H,13,14)/p-1
InChI key:GPMRNXJNBIOINZ-UHFFFAOYSA-N
SMILES:CCOc1ccc(cc1)C(=O)NCC(=O)[O-]
Found 2 products.