CAS 51220-57-6
:N-(4-Methoxybenzoyl)glycine ethyl ester
Description:
N-(4-Methoxybenzoyl)glycine ethyl ester, with the CAS number 51220-57-6, is an organic compound characterized by its structure, which includes a glycine moiety linked to a 4-methoxybenzoyl group through an amide bond. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and methanol, but may have limited solubility in water. The presence of the methoxy group enhances its lipophilicity, which can influence its biological activity and interaction with various biological systems. It is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of bioactive compounds. The compound may exhibit various chemical properties, including reactivity towards nucleophiles due to the carbonyl group in the benzoyl moiety. Additionally, its stability can be influenced by environmental factors such as pH and temperature. Overall, N-(4-Methoxybenzoyl)glycine ethyl ester is of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c1-3-17-11(14)8-13-12(15)9-4-6-10(16-2)7-5-9/h4-7H,3,8H2,1-2H3,(H,13,15)
InChI key:InChIKey=ZFELUNTWQDERLR-UHFFFAOYSA-N
SMILES:C(NCC(OCC)=O)(=O)C1=CC=C(OC)C=C1
Synonyms:- (4-Methoxybenzoylamino)acetic acid ethyl ester
- Ethyl 2-(4-methoxybenzamido)acetate
- Ethyl p-methoxy hippurate
- Glycine, N-(4-methoxybenzoyl)-, ethyl ester
- N-(4-Methoxybenzoyl)glycine ethyl ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethyl 2-(4-methoxybenzamido)acetate
CAS:Formula:C12H15NO4Color and Shape:SolidMolecular weight:237.2518
