CymitQuimica logo

CAS 51282-56-5

:

ethyl 5-chloro-2-nitrobenzoate

Description:
Ethyl 5-chloro-2-nitrobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a chloro group and a nitro group attached to the benzene ring, specifically at the 5 and 2 positions, respectively. This compound typically appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. It is known for its moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. Ethyl 5-chloro-2-nitrobenzoate is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its reactivity and ability to undergo further chemical transformations. Safety considerations include handling it with care, as it may pose risks such as irritation to skin and eyes, and potential toxicity if ingested or inhaled. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability and integrity.
Formula:C9H8ClNO4
InChI:InChI=1/C9H8ClNO4/c1-2-15-9(12)7-5-6(10)3-4-8(7)11(13)14/h3-5H,2H2,1H3
InChI key:RICLVXMCOVKPRW-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc(ccc1N(=O)=O)Cl
Synonyms:
  • Ethyl 5-chloro-2-nitrobenzoate
Found 2 products.