CymitQuimica logo

CAS 5129-61-3

:

Methyl 16-methylheptadecanoate

Description:
Methyl 16-methylheptadecanoate, with the CAS number 5129-61-3, is an ester derived from the fatty acid heptadecanoic acid and methanol. It features a long hydrophobic carbon chain, which contributes to its properties as a fatty acid methyl ester. This compound typically exhibits a waxy or oily texture and is generally insoluble in water due to its nonpolar characteristics, while being soluble in organic solvents. Methyl 16-methylheptadecanoate is often studied for its potential applications in biodiesel production, as well as in the food and cosmetic industries due to its emollient properties. Its molecular structure includes a methyl group at the 16th carbon position, which can influence its physical and chemical behavior, such as melting and boiling points, viscosity, and reactivity. Additionally, like many fatty acid esters, it may undergo hydrolysis in the presence of water or enzymes, leading to the release of fatty acids and methanol. Overall, this compound is of interest in various fields, including biochemistry and industrial applications.
Formula:C19H38O2
InChI:InChI=1S/C19H38O2/c1-18(2)16-14-12-10-8-6-4-5-7-9-11-13-15-17-19(20)21-3/h18H,4-17H2,1-3H3
InChI key:InChIKey=KDQIFKKWPMBNOH-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCC(C)C)(OC)=O
Synonyms:
  • Heptadecanoic acid, 16-methyl-, methyl ester
  • Methyl 16-Methylheptadecanoate
  • 16-Methylheptadecanoic acid methyl ester
Found 3 products.