CymitQuimica logo

CAS 51307-43-8

:

2-Amino-4-hydroxymethylthiazole

Description:
2-Amino-4-hydroxymethylthiazole is an organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to the thiazole structure, contributing to its reactivity and potential biological activity. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which enhances its utility in various chemical applications. The presence of the amino and hydroxymethyl groups allows for hydrogen bonding, influencing its solubility and interaction with other molecules. This compound is of interest in pharmaceutical and biochemical research, particularly for its potential role in synthesizing biologically active compounds. Additionally, its thiazole framework is commonly found in various natural products and pharmaceuticals, making it a valuable building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H6N2OS
InChI:InChI=1/C4H6N2OS/c5-4-6-3(1-7)2-8-4/h2,7H,1H2,(H2,5,6)
InChI key:FNXARVNPSVMCEY-UHFFFAOYSA-N
SMILES:C(c1csc(=N)[nH]1)O
Synonyms:
  • (2-Amino-1,3-thiazol-4-yl)methanol
  • (2-Aminothiazol-4-Yl)Methanol
Found 4 products.