CAS 51309-24-1

N-(2,6-dichlorophenyl)-3-oxobutanamide

Description:

N-(2,6-dichlorophenyl)-3-oxobutanamide, identified by its CAS number 51309-24-1, is an organic compound characterized by its amide functional group and a ketone moiety. This compound features a dichlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of the 3-oxobutanamide structure suggests that it may participate in various chemical reactions, including acylation and condensation reactions. Its molecular structure indicates that it may exhibit polar characteristics due to the amide bond, which can influence its solubility in polar solvents. Additionally, the dichlorophenyl substituent may enhance its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The compound's stability, reactivity, and potential applications can be influenced by the presence of the chlorine atoms, which can affect electronic properties and steric hindrance. Overall, N-(2,6-dichlorophenyl)-3-oxobutanamide is a compound of interest for further research in various chemical and pharmaceutical applications.

Formula: C₁₀H₉Cl₂NO₂

InChI: InChI=1/C10H9Cl2NO2/c1-6(14)5-9(15)13-10-7(11)3-2-4-8(10)12/h2-4H,5H2,1H3,(H,13,15)

InChI key: BPAFBORSRKBCPI-UHFFFAOYSA-N

SMILES: CC(=O)CC(=Nc1c(cccc1Cl)Cl)O

N-(3,4-Dichlorophenyl)-3-oxobutanamide

CAS: 51309-24-1

Formula: C₁₀H₉Cl₂NO₂

Molecular weight: 246.0900

Ref: IN-DA00DFVQ