CymitQuimica logo

CAS 51332-25-3

:

4-(Dimethylamino)-2-(trifluoromethyl)benzonitrile

Description:
4-(Dimethylamino)-2-(trifluoromethyl)benzonitrile, also known by its CAS number 51332-25-3, is an organic compound characterized by its aromatic structure, which includes a benzonitrile moiety. This compound features a dimethylamino group and a trifluoromethyl group attached to the benzene ring, contributing to its unique chemical properties. The presence of the dimethylamino group imparts basic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, often leading to increased stability and reactivity in certain contexts. This compound is typically used in research and development, particularly in the fields of pharmaceuticals and materials science, due to its potential applications in dye synthesis and as a building block for more complex molecules. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and solvents used. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H9F3N2
InChI:InChI=1S/C10H9F3N2/c1-15(2)8-4-3-7(6-14)9(5-8)10(11,12)13/h3-5H,1-2H3
InChI key:InChIKey=HTHPHSCHVAJUNX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C#N)C=CC(N(C)C)=C1
Synonyms:
  • Benzonitrile, 4-(dimethylamino)-2-(trifluoromethyl)-
  • 4-(Dimethylamino)-2-(trifluoromethyl)benzonitrile
Found 3 products.