CymitQuimica logo

CAS 51349-63-4

:

naphthol-as-bi-B-D-galactopyranoside

Description:
Naphthol-AS-bi-B-D-galactopyranoside is a synthetic compound commonly used in biochemical applications, particularly as a substrate in enzyme assays. It is a glycoside, which means it consists of a sugar moiety (in this case, galactopyranoside) linked to a naphthol moiety. This compound is typically utilized in the detection of β-galactosidase activity, as it can be hydrolyzed by this enzyme to release a colored naphthol product, facilitating visual or spectrophotometric measurement. The compound is generally characterized by its solubility in organic solvents and limited solubility in water, which is typical for many naphthol derivatives. Its structure allows for specific interactions with enzymes, making it a valuable tool in molecular biology and biochemistry. Safety data sheets indicate that it should be handled with care, as with many chemical substances, due to potential health hazards associated with exposure. Overall, naphthol-AS-bi-B-D-galactopyranoside serves as an important reagent in research and diagnostic applications.
Formula:C24H24BrNO8
InChI:InChI=1/C24H24BrNO8/c1-32-17-5-3-2-4-16(17)26-23(31)15-9-13-8-14(25)7-6-12(13)10-18(15)33-24-22(30)21(29)20(28)19(11-27)34-24/h2-10,19-22,24,27-30H,11H2,1H3,(H,26,31)/t19-,20+,21+,22-,24-/m1/s1
InChI key:SISGBWZDEMMSLV-KQWJERSKSA-N
SMILES:COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O
Synonyms:
  • Naphthol AS-BI -D-galactopyranoside
  • 7-bromo-3-(beta-D-galactopyranosyloxy)-N-(2-methoxyphenyl)naphthalene-2-carboxamide
Found 4 products.