CymitQuimica logo

CAS 51352-87-5

:

N-benzyl-2-[3-(methoxycarbonyl)phenyl]-N-methylethanaminium chloride

Description:
N-benzyl-2-[3-(methoxycarbonyl)phenyl]-N-methylethanaminium chloride is a quaternary ammonium compound characterized by its complex structure, which includes a benzyl group, a methoxycarbonyl group, and a methylethanaminium moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to its ionic nature. It exhibits properties common to quaternary ammonium salts, such as being a surfactant and having antimicrobial activity. The presence of the methoxycarbonyl group suggests potential reactivity in organic synthesis, particularly in esterification or amidation reactions. Additionally, the compound may have applications in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Its chloride counterion contributes to its solubility and stability in various environments. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Always refer to safety data sheets and conduct proper risk assessments when working with such substances.
Formula:C18H22ClNO2
InChI:InChI=1/C18H21NO2.ClH/c1-19(14-16-7-4-3-5-8-16)12-11-15-9-6-10-17(13-15)18(20)21-2;/h3-10,13H,11-12,14H2,1-2H3;1H
InChI key:HLBBSWSJLPLPRU-UHFFFAOYSA-N
SMILES:CN(CCc1cccc(c1)C(=O)OC)Cc1ccccc1.Cl
Synonyms:
  • Prl-8-53
Found 3 products.