CymitQuimica logo

CAS 51366-39-3

:

N-(3-methyl-4-nitrophenyl)acetamide

Description:
N-(3-methyl-4-nitrophenyl)acetamide, with the CAS number 51366-39-3, is an organic compound characterized by its amide functional group attached to a substituted aromatic ring. The structure features a 3-methyl-4-nitrophenyl moiety, indicating the presence of both a methyl group and a nitro group on the aromatic ring, which can influence its reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent and conditions. The nitro group contributes to its potential as a reactive species in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the presence of the acetamide group suggests that it may participate in hydrogen bonding, affecting its boiling and melting points. Due to its structural characteristics, N-(3-methyl-4-nitrophenyl)acetamide may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and usage, as compounds with nitro groups can pose health risks.
Formula:C9H10N2O3
InChI:InChI=1/C9H10N2O3/c1-6-5-8(10-7(2)12)3-4-9(6)11(13)14/h3-5H,1-2H3,(H,10,12)
InChI key:HTOMFNRBNSBPIU-UHFFFAOYSA-N
SMILES:Cc1cc(ccc1N(=O)=O)N=C(C)O
Synonyms:
  • 3-Methyl-4-nitroacetanilide
Found 4 products.