CAS 51375-99-6
:3-(3,4-dihydroisoquinolin-2(1H)-yl)propanoic acid
Description:
3-(3,4-Dihydroisoquinolin-2(1H)-yl)propanoic acid, with the CAS number 51375-99-6, is an organic compound characterized by its unique structure that includes a propanoic acid moiety linked to a 3,4-dihydroisoquinoline ring system. This compound typically exhibits properties associated with both the isoquinoline and carboxylic acid functional groups. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The isoquinoline portion may contribute to its biological activity, as many isoquinoline derivatives are known for their pharmacological properties. The compound may also exhibit acidic behavior due to the carboxylic acid group, which can donate protons in solution. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or cardiovascular conditions, given the structural motifs present. However, specific biological activities and interactions would require further investigation through empirical studies.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c14-12(15)6-8-13-7-5-10-3-1-2-4-11(10)9-13/h1-4H,5-9H2,(H,14,15)
InChI key:ITBODVOTGPHBBW-UHFFFAOYSA-N
SMILES:C1CN(CC2=CC=CC=C21)CCC(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
