CymitQuimica logo

CAS 51385-93-4

:

2,7-dimethoxynaphthalene-1-carbaldehyde

Description:
2,7-Dimethoxynaphthalene-1-carbaldehyde is an organic compound characterized by its naphthalene backbone, which features two methoxy groups (-OCH3) at the 2 and 7 positions and an aldehyde group (-CHO) at the 1 position. This structure contributes to its aromatic properties and potential reactivity. The presence of the methoxy groups enhances its solubility in organic solvents and can influence its electronic properties, making it a useful intermediate in organic synthesis and materials science. The aldehyde functional group is reactive, allowing for further chemical transformations, such as condensation reactions or reductions. This compound may exhibit fluorescence due to its aromatic nature, and its derivatives are often explored in the development of dyes and pharmaceuticals. Additionally, its physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C13H12O3
InChI:InChI=1/C13H12O3/c1-15-10-5-3-9-4-6-13(16-2)12(8-14)11(9)7-10/h3-8H,1-2H3
InChI key:PTTJQHKRNJYUGV-UHFFFAOYSA-N
SMILES:COc1ccc2ccc(c(C=O)c2c1)OC
Synonyms:
  • 1-Naphthalenecarboxaldehyde, 2,7-Dimethoxy-
  • 2,7-Dimethoxy-1-Naphthaldehyde
Found 2 products.