CymitQuimica logo

CAS 51391-96-9

:

5-Methylcyclocytidine hydrochlorine

Description:
5-Methylcyclocytidine hydrochloride is a modified nucleoside that is part of the broader category of nucleoside analogs. It features a cyclopentane ring fused to a pyrimidine base, which contributes to its unique structural properties. This compound is characterized by the presence of a methyl group at the 5-position of the cytidine base, which can influence its biological activity and stability. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various biochemical applications. 5-Methylcyclocytidine has garnered interest in research, particularly in the fields of molecular biology and medicinal chemistry, due to its potential role in RNA modification and its implications in therapeutic development. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and formulations used. Overall, this compound represents a significant area of study for understanding nucleoside function and the development of antiviral and anticancer agents.
Formula:C10H14ClN3O4
InChI:InChI=1S/C10H13N3O4.ClH/c1-4-2-13-9-7(6(15)5(3-14)16-9)17-10(13)12-8(4)11;/h2,5-7,9,11,14-15H,3H2,1H3;1H/t5-,6-,7+,9-;/m1./s1
InChI key:NTLAKIOXMNOMIC-HSMTUSTJSA-N
SMILES:CC1=CN2[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)OC2=NC1=N.Cl
Synonyms:
  • CMC.HCl
  • Cmc・Hci
  • (2R-(2Alpha,3Beta,3Abeta,9Abeta))-2,3,3A,9A-Tetrahydro-3-Hydroxy-6-Imino-7-Methyl-6H-Furo(2',3':4,5)Oxazolo(3,2-A)Pyrimidine-2-Methanol Monohydrochloride
Found 6 products.