CymitQuimica logo

CAS 51395-52-9

:

4-bromo-5-methyl-2,4-dihydro-3H-pyrazol-3-one

Description:
4-Bromo-5-methyl-2,4-dihydro-3H-pyrazol-3-one is a heterocyclic organic compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound is typically a white to off-white solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the bromine atom and the methyl group contributes to its reactivity and solubility properties. It may exhibit various functional properties, including anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. The compound's molecular structure allows for various chemical modifications, which can enhance its efficacy or alter its pharmacokinetic properties. As with many pyrazolones, it may also participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, further expanding its utility in synthetic organic chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.
Formula:C4H5BrN2O
InChI:InChI=1/C4H5BrN2O/c1-2-3(5)4(8)7-6-2/h3H,1H3,(H,7,8)
InChI key:PFZZZDVWAXUXGE-UHFFFAOYSA-N
SMILES:CC1=NN=C(C1Br)O
Found 4 products.