CymitQuimica logo

CAS 514-66-9

:

Rubropunctamine

Description:
Rubropunctamine, with the CAS number 514-66-9, is a chemical compound that belongs to the class of alkaloids, specifically derived from certain species of fungi. It is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Rubropunctamine exhibits notable pharmacological properties, including potential antimicrobial and cytotoxic effects, making it of interest in medicinal chemistry and drug development. The compound is typically isolated from natural sources, and its synthesis can be challenging due to its intricate structure. In terms of physical properties, rubropunctamine may display distinct solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Research into rubropunctamine continues to explore its mechanisms of action and potential therapeutic applications, particularly in the fields of oncology and infectious diseases.
Formula:C21H23NO4
InChI:InChI=1S/C21H23NO4/c1-4-6-7-9-17(23)18-16-11-13-10-14(8-5-2)22-12-15(13)19(24)21(16,3)26-20(18)25/h5,8,10-12,22H,4,6-7,9H2,1-3H3/b8-5+/t21-/m1/s1
InChI key:InChIKey=OVOAWDOEFJNCGI-WKOQKXSESA-N
SMILES:C[C@]12C(=C(C(CCCCC)=O)C(=O)O1)C=C3C(C2=O)=CNC(/C=C/C)=C3
Synonyms:
  • Furo[3,2-g]isoquinoline-2,9(7H,9aH)-dione, 9a-methyl-3-(1-oxohexyl)-6-(1E)-1-propenyl-, (9aR)-
  • Rubropunctatamine
  • Furo[3,2-g]isoquinoline-2,9(7H,9aH)-dione, 9a-methyl-3-(1-oxohexyl)-6-(1-propenyl)-, [R-(E)]-
  • Furo[3,2-g]isoquinoline-2,9(7H,9aH)-dione, 9a-methyl-3-(1-oxohexyl)-6-(1E)-1-propen-1-yl-, (9aR)-
  • (9aR)-9a-Methyl-3-(1-oxohexyl)-6-(1E)-1-propen-1-ylfuro[3,2-g]isoquinoline-2,9(7H,9aH)-dione
Found 9 products.