CymitQuimica logo

CAS 5144-11-6

:

1,5-Dimethyl-1H-tetrazole

Description:
1,5-Dimethyl-1H-tetrazole is a heterocyclic organic compound characterized by its tetrazole ring, which consists of four nitrogen atoms and one carbon atom. This compound features two methyl groups attached to the first and fifth positions of the tetrazole ring, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid that is soluble in polar solvents such as water and alcohols. The presence of nitrogen in its structure imparts notable stability and reactivity, making it of interest in various applications, including pharmaceuticals and as a potential energetic material. 1,5-Dimethyl-1H-tetrazole can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the electron-rich nature of the tetrazole ring. Its CAS number, 5144-11-6, is used for identification in chemical databases. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles and their utility in synthetic and applied chemistry.
Formula:C3H6N4
InChI:InChI=1S/C3H6N4/c1-3-4-5-6-7(3)2/h1-2H3
InChI key:InChIKey=HWHNFJYQDMSYAF-UHFFFAOYSA-N
SMILES:CC=1N(C)N=NN1
Synonyms:
  • 1,2,3,4-Tetrazole, 1,5-dimethyl-
  • 1H-Tetrazole, 1,5-dimethyl-
  • 1,5-Dimethyltetrazole
  • Tetrazole, 1,5-dimethyl-
  • 1,5-Dimethyl-1H-tetrazole
Found 1 products.