CymitQuimica logo

CAS 51446-30-1

:

2-Fluoro-5-hydroxybenzoic acid

Description:
2-Fluoro-5-hydroxybenzoic acid is an aromatic compound characterized by the presence of a fluorine atom and a hydroxyl group on a benzoic acid framework. The fluorine atom is located at the second position, while the hydroxyl group is at the fifth position of the benzene ring, contributing to its unique reactivity and properties. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid and hydroxyl functional groups. It exhibits acidic behavior, capable of donating a proton from the carboxylic acid group. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. 2-Fluoro-5-hydroxybenzoic acid may be utilized in organic synthesis and pharmaceutical applications, particularly in the development of biologically active compounds. Its specific interactions and applications can vary based on the context of use, making it a compound of interest in both research and industrial settings.
Formula:C7H5FO3
InChI:InChI=1/C7H5FO3/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,9H,(H,10,11)
InChI key:InChIKey=CZNFABVUVHWEJF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=CC(O)=C1
Synonyms:
  • 6-Fluoro-3-hydroxybenzoic acid
  • Benzoic acid, 2-fluoro-5-hydroxy-
  • Qvr Cq Ff
  • 2-Fluoro-5-hydroxybenzoic acid
Found 5 products.