CymitQuimica logo

CAS 51454-64-9

:

2-(Chloromethyl)-4-pyridinecarbonitrile

Description:
2-(Chloromethyl)-4-pyridinecarbonitrile, with the CAS number 51454-64-9, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) and a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the cyano group imparts significant polarity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the chloromethyl group can participate in nucleophilic substitution reactions, enhancing its utility in further chemical transformations. Safety data indicates that it should be handled with care due to its potential toxicity and reactivity. Overall, 2-(Chloromethyl)-4-pyridinecarbonitrile is a valuable compound in synthetic organic chemistry, particularly in the development of nitrogen-containing heterocycles.
Formula:C7H5ClN2
InChI:InChI=1S/C7H5ClN2/c8-4-7-3-6(5-9)1-2-10-7/h1-3H,4H2
InChI key:InChIKey=DENUXIGZQGZLCB-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(CCl)N=CC1
Synonyms:
  • 2-(Chloromethyl)-4-pyridinecarbonitrile
  • 2-(Chloromethyl)isonicotinonitrile
  • 4-Pyridinecarbonitrile, 2-(chloromethyl)-
Found 2 products.