CymitQuimica logo

CAS 514797-96-7

:

2(1H)-Pyridinone, 5-chloro-3-fluoro-

Description:
2(1H)-Pyridinone, 5-chloro-3-fluoro- is a heterocyclic organic compound characterized by a pyridinone structure, which features a nitrogen atom within a six-membered aromatic ring containing a carbonyl group. The presence of chlorine and fluorine substituents at the 5 and 3 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carbonyl group. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The halogen substituents can influence the compound's electronic properties, making it of interest in medicinal chemistry for the development of biologically active molecules. Additionally, the compound's stability and reactivity can be affected by the presence of these halogens, which may participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions. Overall, 2(1H)-Pyridinone, 5-chloro-3-fluoro- is a compound of interest for further research and application in various chemical fields.
Formula:C5H3ClFNO
InChI:InChI=1/C5H3ClFNO/c6-3-1-4(7)5(9)8-2-3/h1-2H,(H,8,9)
InChI key:AKLNMOLGRGQMFY-UHFFFAOYSA-N
SMILES:c1c(cnc(c1F)O)Cl
Synonyms:
  • 2-Pyridinol, 5-Chloro-3-Fluoro-
  • 5-Chloro-3-fluoropyridin-2(1H)-one
  • 5-Chloro-3-fluoropyridin-2-ol
Found 5 products.