CymitQuimica logo

CAS 514821-14-8

:

1-bromo-2-(2-methylprop-2-en-1-yl)benzene

Description:
1-Bromo-2-(2-methylprop-2-en-1-yl)benzene, with the CAS number 514821-14-8, is an organic compound characterized by the presence of a bromine atom and a substituted allyl group attached to a benzene ring. This compound features a bromine atom at the second position of the benzene, while the allyl group, which is a 2-methylprop-2-en-1-yl moiety, is attached at the first position. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is likely to exhibit hydrophobic characteristics due to the aromatic nature of the benzene ring, influencing its solubility in organic solvents rather than in water. Additionally, the presence of the double bond in the allyl group can lead to further reactivity, allowing for potential polymerization or addition reactions. Overall, this compound's structure suggests it may be useful in synthetic organic chemistry, particularly in the development of more complex molecules.
Formula:C10H11Br
InChI:InChI=1/C10H11Br/c1-8(2)7-9-5-3-4-6-10(9)11/h3-6H,1,7H2,2H3
InChI key:InChIKey=GDDZJVPXQFSMSV-UHFFFAOYSA-N
SMILES:C(C(C)=C)C1=C(Br)C=CC=C1
Synonyms:
  • 1-Bromo-2-(2-methylprop-2-enyl)benzene
  • Benzene, 1-bromo-2-(2-methyl-2-propenyl)-
  • 1-Bromo-2-(2-methyl-2-propen-1-yl)benzene
  • Benzene, 1-bromo-2-(2-methyl-2-propen-1-yl)-
  • 3-(2-Bromophenyl)-2-methyl-1-propene
Found 2 products.