CymitQuimica logo

CAS 51483-92-2

:

6-bromochromone

Description:
6-Bromochromone is an organic compound belonging to the chromone family, characterized by a benzopyranone structure. It features a bromine atom substituted at the 6-position of the chromone ring, which contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of the bromine atom can influence its reactivity and solubility in various solvents. 6-Bromochromone can participate in various chemical reactions, such as electrophilic substitutions and nucleophilic additions, making it a valuable intermediate in organic synthesis. Additionally, it may serve as a scaffold for the development of pharmaceuticals and agrochemicals. Its molecular structure allows for the possibility of forming derivatives that can enhance its biological activity or alter its physical properties. As with many brominated compounds, care should be taken regarding its environmental impact and toxicity, necessitating proper handling and disposal practices in laboratory settings.
Formula:C9H5BrO2
InChI:InChI=1/C9H5BrO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H
InChI key:XVNBWGGBXOJIDR-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Br)c(=O)cco2
Synonyms:
  • 6-bromo-4H-chromen-4-one
Found 6 products.