CymitQuimica logo

CAS 51486-04-5

:

2-amino-4,5-dimethylthiophene-3-carboxamide

Description:
2-Amino-4,5-dimethylthiophene-3-carboxamide is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the thiophene ring, contributing to its potential as a building block in pharmaceuticals and agrochemicals. The presence of two methyl groups at the 4 and 5 positions of the thiophene enhances its hydrophobic character and may influence its biological activity. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxamide group, while the thiophene ring provides stability and aromaticity. Its chemical properties may include reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored in medicinal chemistry. Overall, 2-amino-4,5-dimethylthiophene-3-carboxamide is a versatile compound with interesting chemical and biological properties.
Formula:C7H10N2OS
InChI:InChI=1/C7H10N2OS/c1-3-4(2)11-7(9)5(3)6(8)10/h9H2,1-2H3,(H2,8,10)
InChI key:ZKXSEMXZKAQARN-UHFFFAOYSA-N
SMILES:Cc1c(C)sc(c1C(=O)N)N
Synonyms:
  • 3-Thiophenecarboxamide, 2-Amino-4,5-Dimethyl-
Found 4 products.