CAS 51512-27-7

2-Propenoic acid, 2-cyanoethyl ester, homopolymer

Description:

2-Propenoic acid, 2-cyanoethyl ester, homopolymer, commonly referred to as poly(2-cyanoethyl acrylate), is a synthetic polymer derived from the polymerization of 2-cyanoethyl acrylate monomers. This polymer exhibits several notable characteristics, including good thermal stability and resistance to various chemicals, making it suitable for applications in coatings, adhesives, and sealants. The presence of cyanoethyl groups imparts unique properties, such as enhanced polarity and potential for further functionalization. The polymer typically has a high degree of flexibility and can be processed into various forms, including films and fibers. Additionally, it may exhibit varying degrees of solubility in organic solvents, depending on its molecular weight and the specific conditions of the environment. Its mechanical properties can be tailored through copolymerization or blending with other materials, allowing for a wide range of applications in industries such as electronics, automotive, and biomedical fields. Overall, poly(2-cyanoethyl acrylate) is valued for its versatility and performance in specialized applications.

Formula: (C₆H₇NO₂)x

InChI: InChI=1S/C6H7NO2/c1-2-6(8)9-5-3-4-7/h2H,1,3,5H2

InChI key: InChIKey=AEPWOCLBLLCOGZ-UHFFFAOYSA-N

SMILES: C(OCCC#N)(C=C)=O

Synonyms:

• Poly(2-cyanoethyl acrylate)
• β-Cyanoethyl acrylate polymer
• 2-Propenoic acid, 2-cyanoethyl ester, homopolymer
• Cyanoethyl acrylate polymer
• Poly(cyanoethyl acrylate)

2-Propenoic acid, 2-cyanoethyl ester, homopolymer

CAS: 51512-27-7

Formula: C₆H₇NO₂

Molecular weight: 125.1253

Ref: IN-DA01X3RC