CymitQuimica logo

CAS 51522-07-7

:

4-chloro-3-(methylsulfonyl)benzoate

Description:
4-Chloro-3-(methylsulfonyl)benzoate, with the CAS number 51522-07-7, is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with a chlorine atom and a methylsulfonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic ring. The presence of the chloro and methylsulfonyl groups contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. It may also serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound's properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Safety data sheets should be consulted for handling and storage guidelines, as the presence of chlorine may indicate potential toxicity or environmental hazards. Overall, 4-chloro-3-(methylsulfonyl)benzoate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C8H6ClO4S
InChI:InChI=1/C8H7ClO4S/c1-14(12,13)7-4-5(8(10)11)2-3-6(7)9/h2-4H,1H3,(H,10,11)/p-1
InChI key:ZWBQTUAUWSDCKX-UHFFFAOYSA-N
SMILES:CS(=O)(=O)c1cc(ccc1Cl)C(=O)[O-]
Found 4 products.