CAS 5153-73-1
:4-(2-nitroethenyl)benzonitrile
Description:
4-(2-Nitroethenyl)benzonitrile, with the CAS number 5153-73-1, is an organic compound characterized by its aromatic structure and the presence of both a nitrile and a nitro group. This compound features a benzene ring substituted with a nitrile group (-C≡N) and a 2-nitroethenyl group, which is a vinyl group (–CH=CH2) with a nitro substituent (–NO2) at the second carbon. The presence of these functional groups imparts unique chemical properties, including potential reactivity in electrophilic aromatic substitution and other organic reactions. The nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. Additionally, 4-(2-nitroethenyl)benzonitrile may exhibit interesting optical properties due to its conjugated system, making it of interest in materials science and organic synthesis. Its solubility and behavior in various solvents can vary, depending on the polarity and nature of the solvent used. Overall, this compound is significant in the context of organic chemistry and materials research.
Formula:C9H6N2O2
InChI:InChI=1/C9H6N2O2/c10-7-9-3-1-8(2-4-9)5-6-11(12)13/h1-6H
SMILES:c1cc(ccc1C=CN(=O)=O)C#N
Synonyms:- 4-(2-Nitrovinyl)benzonitrile
- Benzonitrile, 4-(2-Nitroethenyl)-
- 4-[(E)-2-nitroethenyl]benzonitrile
- 4-[(E)-2-Nitrovinyl]benzonitrile
- benzonitrile, 4-[(E)-2-nitroethenyl]-
- trans-4-(2-Nitroethenyl)benzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
trans-4-(2-Nitroethenyl)benzonitrile
CAS:Formula:C9H6N2O2Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:174.16Benzonitrile, 4-[(1E)-2-nitroethenyl]-
CAS:Formula:C9H6N2O2Purity:98%Color and Shape:SolidMolecular weight:174.15611-(4-Cyanophenyl)-2-nitroethene
CAS:1-(4-Cyanophenyl)-2-nitroetheneFormula:C9H6N2O2Purity:98%Molecular weight:174.156141-(4-Cyanophenyl)-2-nitroethene
CAS:1-(4-Cyanophenyl)-2-nitroethene is a reactive intermediate that belongs to the group of carboxylic acids. It is an unsaturated compound with a cinnamic acid derivative. The nitration of 1-(4-cyanophenyl)-2-nitroethene leads to the formation of 1,2-dinitrobenzene, which can be used for the synthesis of other heterocyclic compounds. This intermediate has been shown to have catalytic activity in biomolecules, including carboxylic and phenolic groups, and can be used for the synthesis of other organic compounds.Formula:C9H6N2O2Purity:Min. 95%Molecular weight:174.16 g/moltrans-4-(2-Nitroethenyl)benzonitrile
CAS:(E)-4-(2-Nitrovinyl)benzonitrileFormula:C9H6N2O2Purity:98%Molecular weight:174.16(E)-4-(2-Nitrovinyl)benzonitrile
CAS:Formula:C9H6N2O2Purity:95.0%Color and Shape:SolidMolecular weight:174.159





